C19H24O7S — CID 134831489
[(6S,8aS)-7-acetyloxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 134831489) has the molecular formula C19H24O7S and a molecular weight of 396.46 g/mol. Its IUPAC name is [(6S,8aS)-7-acetyloxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(6S,8aS)-7-acetyloxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 134831489 |
| Molecular Formula | C19H24O7S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [(6S,8aS)-7-acetyloxy-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CCS[C@@H]1OC2COC(c3ccccc3)O[C@@H]2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H24O7S/c1-4-27-19-17(24-12(3)21)16(23-11(2)20)15-14(25-19)10-22-18(26-15)13-8-6-5-7-9-13/h5-9,14-19H,4,10H2,1-3H3/t14?,15-,16?,17?,18?,19-/m0/s1 |
| InChIKey | BGOREHVDTRERIG-SLMDSZGXSA-N |
| XLogP | 2.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |