C27H41NO5Si — CID 134831589
(4R)-4-benzyl-3-[(2S)-2-methyl-6-[(2S,3S,5R)-3-methyl-5-(2-trimethylsilylethoxy)oxolan-2-yl]hex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 134831589) has the molecular formula C27H41NO5Si and a molecular weight of 487.71 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2S)-2-methyl-6-[(2S,3S,5R)-3-methyl-5-(2-trimethylsilylethoxy)oxolan-2-yl]hex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2S)-2-methyl-6-[(2S,3S,5R)-3-methyl-5-(2-trimethylsilylethoxy)oxolan-2-yl]hex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134831589 |
| Molecular Formula | C27H41NO5Si |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (4R)-4-benzyl-3-[(2S)-2-methyl-6-[(2S,3S,5R)-3-methyl-5-(2-trimethylsilylethoxy)oxolan-2-yl]hex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](CC=CC[C@@H]1O[C@@H](OCC[Si](C)(C)C)C[C@@H]1C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H41NO5Si/c1-20(26(29)28-23(19-32-27(28)30)18-22-12-7-6-8-13-22)11-9-10-14-24-21(2)17-25(33-24)31-15-16-34(3,4)5/h6-10,12-13,20-21,23-25H,11,14-19H2,1-5H3/t20-,21-,23+,24-,25+/m0/s1 |
| InChIKey | GCKVHZFJFLYVCX-QYQUALKTSA-N |
| XLogP | 5.65 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|