C21H17NO3 — CID 134833093
5-ethyl-7-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),13,15,17,19-heptaene-6,10-dione (PubChem CID 134833093) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is 5-ethyl-7-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),13,15,17,19-heptaene-6,10-dione.
| Compound Name | 5-ethyl-7-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),13,15,17,19-heptaene-6,10-dione |
|---|---|
| PubChem CID | 134833093 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-ethyl-7-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),13,15,17,19-heptaene-6,10-dione |
| SMILES | CCC1C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3cc2-1 |
| InChI | InChI=1S/C21H17NO3/c1-2-15-17-9-19-16-8-13-6-4-3-5-12(13)7-14(16)10-22(19)20(23)18(17)11-25-21(15)24/h3-9,15H,2,10-11H2,1H3 |
| InChIKey | PFTBQOOAYBNHPE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |