C24H23N3O3 — CID 177180533
10-ethyl-19-(methylamino)-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione (PubChem CID 177180533) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 10-ethyl-19-(methylamino)-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione.
| Compound Name | 10-ethyl-19-(methylamino)-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
|---|---|
| PubChem CID | 177180533 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 10-ethyl-19-(methylamino)-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16(24),17,19-heptaene-5,9-dione |
| SMILES | CCC1C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(NC)c3c1c2CCC3 |
| InChI | InChI=1S/C24H23N3O3/c1-3-12-15-9-20-22-16(10-27(20)23(28)17(15)11-30-24(12)29)13-5-4-6-14-18(25-2)7-8-19(26-22)21(13)14/h7-9,12,25H,3-6,10-11H2,1-2H3 |
| InChIKey | LHHJOSQLHMECOU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |