About CID 134833437
CID 134833437 (PubChem CID 134833437) has the molecular formula C20H18BNO2P+
and a molecular weight of 346.16 g/mol.
Molecular Properties
| Compound Name | CID 134833437 |
| PubChem CID | 134833437 |
| Molecular Formula | C20H18BNO2P+ |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | — |
| SMILES | [B][P+](c1ccccc1)(c1ccccc1)C(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H18BNO2P/c21-25(18-12-6-2-7-13-18,19-14-8-3-9-15-19)20(16-22(23)24)17-10-4-1-5-11-17/h1-15,20H,16H2/q+1 |
| InChIKey | NIVHPOITFVVWBB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 134833437 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134833437?
The IUPAC name of CID 134833437 (CID 134833437) is not available.
What is the SMILES notation for CID 134833437?
The canonical SMILES for CID 134833437 is [B][P+](c1ccccc1)(c1ccccc1)C(C[N+](=O)[O-])c1ccccc1.
What is the InChIKey of CID 134833437?
The InChIKey is NIVHPOITFVVWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BNO2P/c21-25(18-12-6-2-7-13-18,19-14-8-3-9-15-19)20(16-22(23)24)17-10-4-1-5-11-17/h1-15,20H,16H2/q+1.
What are the key properties of CID 134833437?
CID 134833437 has a molecular weight of 346.16 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134833437 is sourced from PubChem (CID 134833437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).