C13H11N3O2 — CID 134833517
2-methyl-[1]benzofuro[2,3-b]pyridine-4-carbohydrazide (PubChem CID 134833517) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-methyl-[1]benzofuro[2,3-b]pyridine-4-carbohydrazide.
| Compound Name | 2-methyl-[1]benzofuro[2,3-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 134833517 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-methyl-[1]benzofuro[2,3-b]pyridine-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)NN)c2c(n1)oc1ccccc12 |
| InChI | InChI=1S/C13H11N3O2/c1-7-6-9(12(17)16-14)11-8-4-2-3-5-10(8)18-13(11)15-7/h2-6H,14H2,1H3,(H,16,17) |
| InChIKey | ARJKHJJTHLSDMA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|