C18H24O7S — CID 134833911
[(2S,5S)-3-acetyloxy-2-methoxy-6-(phenylmethoxymethyl)-5-sulfanyloxan-4-yl] acetate (PubChem CID 134833911) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is [(2S,5S)-3-acetyloxy-2-methoxy-6-(phenylmethoxymethyl)-5-sulfanyloxan-4-yl] acetate.
| Compound Name | [(2S,5S)-3-acetyloxy-2-methoxy-6-(phenylmethoxymethyl)-5-sulfanyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 134833911 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(2S,5S)-3-acetyloxy-2-methoxy-6-(phenylmethoxymethyl)-5-sulfanyloxan-4-yl] acetate |
| SMILES | CO[C@H]1OC(COCc2ccccc2)[C@H](S)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H24O7S/c1-11(19)23-15-16(24-12(2)20)18(21-3)25-14(17(15)26)10-22-9-13-7-5-4-6-8-13/h4-8,14-18,26H,9-10H2,1-3H3/t14?,15?,16?,17-,18-/m0/s1 |
| InChIKey | RHWPFRYYTHCYPO-PAOLREHBSA-N |
| XLogP | 1.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|