C23H33NO2Si — CID 13483445
(E)-N,N-dibenzyl-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenamine (PubChem CID 13483445) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is (E)-N,N-dibenzyl-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenamine.
| Compound Name | (E)-N,N-dibenzyl-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenamine |
|---|---|
| PubChem CID | 13483445 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (E)-N,N-dibenzyl-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenamine |
| SMILES | CC(C)(C)O/C(=C\N(Cc1ccccc1)Cc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C23H33NO2Si/c1-23(2,3)25-22(26-27(4,5)6)19-24(17-20-13-9-7-10-14-20)18-21-15-11-8-12-16-21/h7-16,19H,17-18H2,1-6H3/b22-19+ |
| InChIKey | JFHKZQNRSOWLLR-ZBJSNUHESA-N |
| XLogP | 6.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|