C22H29NO2Si — CID 11824747
N-[(E)-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenyl]-1,1-diphenylmethanimine (PubChem CID 11824747) has the molecular formula C22H29NO2Si and a molecular weight of 367.56 g/mol. Its IUPAC name is N-[(E)-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenyl]-1,1-diphenylmethanimine.
| Compound Name | N-[(E)-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 11824747 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[(E)-2-[(2-methylpropan-2-yl)oxy]-2-trimethylsilyloxyethenyl]-1,1-diphenylmethanimine |
| SMILES | CC(C)(C)O/C(=C\N=C(c1ccccc1)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C22H29NO2Si/c1-22(2,3)24-20(25-26(4,5)6)17-23-21(18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17H,1-6H3/b20-17+ |
| InChIKey | WRODOEWEOBGILL-LVZFUZTISA-N |
| XLogP | 5.99 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|