C19H18O3 — CID 134835424
(Z)-2-(methoxymethyl)-1,5-diphenylpent-1-en-4-yne-1,3-diol (PubChem CID 134835424) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (Z)-2-(methoxymethyl)-1,5-diphenylpent-1-en-4-yne-1,3-diol.
| Compound Name | (Z)-2-(methoxymethyl)-1,5-diphenylpent-1-en-4-yne-1,3-diol |
|---|---|
| PubChem CID | 134835424 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (Z)-2-(methoxymethyl)-1,5-diphenylpent-1-en-4-yne-1,3-diol |
| SMILES | COC/C(=C(/O)c1ccccc1)C(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C19H18O3/c1-22-14-17(19(21)16-10-6-3-7-11-16)18(20)13-12-15-8-4-2-5-9-15/h2-11,18,20-21H,14H2,1H3/b19-17- |
| InChIKey | ZHBGYOPVABVJDH-ZPHPHTNESA-N |
| XLogP | 3.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|