C30H6F10O2S2 — CID 134835645
7,17-bis(2,3,4,5,6-pentafluorophenyl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,7,9,14,17,19-octaene-2,12-dione (PubChem CID 134835645) has the molecular formula C30H6F10O2S2 and a molecular weight of 652.49 g/mol. Its IUPAC name is 7,17-bis(2,3,4,5,6-pentafluorophenyl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,7,9,14,17,19-octaene-2,12-dione.
| Compound Name | 7,17-bis(2,3,4,5,6-pentafluorophenyl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,7,9,14,17,19-octaene-2,12-dione |
|---|---|
| PubChem CID | 134835645 |
| Molecular Formula | C30H6F10O2S2 |
| Molecular Weight | 652.49 g/mol |
| Exact Mass | 651.96 |
| IUPAC Name | 7,17-bis(2,3,4,5,6-pentafluorophenyl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,7,9,14,17,19-octaene-2,12-dione |
| SMILES | O=C1c2cc3cc(-c4c(F)c(F)c(F)c(F)c4F)sc3cc2C(=O)c2cc3cc(-c4c(F)c(F)c(F)c(F)c4F)sc3cc21 |
| InChI | InChI=1S/C30H6F10O2S2/c31-19-17(20(32)24(36)27(39)23(19)35)15-3-7-1-9-11(5-13(7)43-15)30(42)10-2-8-4-16(44-14(8)6-12(10)29(9)41)18-21(33)25(37)28(40)26(38)22(18)34/h1-6H |
| InChIKey | GEDFMMZECCWXAA-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.49 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|