C36H10F8N2S6 — CID 170274980
2,5-bis[6-(2,3,4,5-tetrafluorophenyl)thieno[2,3-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 170274980) has the molecular formula C36H10F8N2S6 and a molecular weight of 814.88 g/mol. Its IUPAC name is 2,5-bis[6-(2,3,4,5-tetrafluorophenyl)thieno[2,3-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis[6-(2,3,4,5-tetrafluorophenyl)thieno[2,3-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 170274980 |
| Molecular Formula | C36H10F8N2S6 |
| Molecular Weight | 814.88 g/mol |
| Exact Mass | 813.90 |
| IUPAC Name | 2,5-bis[6-(2,3,4,5-tetrafluorophenyl)thieno[2,3-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | Fc1cc(-c2cc3cc4sc(-c5nc6sc(-c7cc8cc9sc(-c%10cc(F)c(F)c(F)c%10F)cc9cc8s7)nc6s5)cc4cc3s2)c(F)c(F)c1F |
| InChI | InChI=1S/C36H10F8N2S6/c37-17-9-15(27(39)31(43)29(17)41)23-5-11-1-21-13(3-19(11)47-23)7-25(49-21)33-45-35-36(51-33)46-34(52-35)26-8-14-4-20-12(2-22(14)50-26)6-24(48-20)16-10-18(38)30(42)32(44)28(16)40/h1-10H |
| InChIKey | TVFDGWXPAPOMSQ-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.88 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|