C18H19NO6 — CID 134836264
dimethyl 4-(2-methoxy-2-oxoethyl)-1-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 134836264) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is dimethyl 4-(2-methoxy-2-oxoethyl)-1-phenyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(2-methoxy-2-oxoethyl)-1-phenyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 134836264 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | dimethyl 4-(2-methoxy-2-oxoethyl)-1-phenyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)CC1C(C(=O)OC)=CN(c2ccccc2)C=C1C(=O)OC |
| InChI | InChI=1S/C18H19NO6/c1-23-16(20)9-13-14(17(21)24-2)10-19(11-15(13)18(22)25-3)12-7-5-4-6-8-12/h4-8,10-11,13H,9H2,1-3H3 |
| InChIKey | IVAIFWKAAWNHKR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|