C19H34O6 — CID 134836602
ethyl 3-[(4S,5R)-5-[(6S)-6-acetyloxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 134836602) has the molecular formula C19H34O6 and a molecular weight of 358.48 g/mol. Its IUPAC name is ethyl 3-[(4S,5R)-5-[(6S)-6-acetyloxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | ethyl 3-[(4S,5R)-5-[(6S)-6-acetyloxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 134836602 |
| Molecular Formula | C19H34O6 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | ethyl 3-[(4S,5R)-5-[(6S)-6-acetyloxyheptyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1OC(C)(C)O[C@@H]1CCCCC[C@H](C)OC(C)=O |
| InChI | InChI=1S/C19H34O6/c1-6-22-18(21)13-12-17-16(24-19(4,5)25-17)11-9-7-8-10-14(2)23-15(3)20/h14,16-17H,6-13H2,1-5H3/t14-,16+,17-/m0/s1 |
| InChIKey | JOPVQJOPRIPNJJ-UAGQMJEPSA-N |
| XLogP | 3.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|