C18H30O5SSi — CID 134836831
2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 134836831) has the molecular formula C18H30O5SSi and a molecular weight of 386.59 g/mol. Its IUPAC name is 2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134836831 |
| Molecular Formula | C18H30O5SSi |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2O[C@H]2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30O5SSi/c1-14-7-9-15(10-8-14)24(19,20)21-12-11-16-17(23-16)13-22-25(5,6)18(2,3)4/h7-10,16-17H,11-13H2,1-6H3/t16-,17-/m0/s1 |
| InChIKey | CSICYZYBFKIBBV-IRXDYDNUSA-N |
| XLogP | 3.88 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|