C20H42O5Si2 — CID 134838421
3-[(6aR,8S,9aR)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-1-ol (PubChem CID 134838421) has the molecular formula C20H42O5Si2 and a molecular weight of 418.72 g/mol. Its IUPAC name is 3-[(6aR,8S,9aR)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-1-ol.
| Compound Name | 3-[(6aR,8S,9aR)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 134838421 |
| Molecular Formula | C20H42O5Si2 |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 3-[(6aR,8S,9aR)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-1-ol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](CCCO)C[C@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C20H42O5Si2/c1-14(2)26(15(3)4)22-13-20-19(12-18(23-20)10-9-11-21)24-27(25-26,16(5)6)17(7)8/h14-21H,9-13H2,1-8H3/t18-,19+,20+/m0/s1 |
| InChIKey | CKVQYKQPBPNZBC-XUVXKRRUSA-N |
| XLogP | 4.87 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|