C21H22N2O4 — CID 134838547
methyl (9S,11R,14R,15S,16E)-16-ethylidene-12,20-dioxa-2,18-diazaheptacyclo[9.8.1.115,19.01,9.03,8.09,14.013,18]henicosa-3,5,7-triene-14-carboxylate (PubChem CID 134838547) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl (9S,11R,14R,15S,16E)-16-ethylidene-12,20-dioxa-2,18-diazaheptacyclo[9.8.1.115,19.01,9.03,8.09,14.013,18]henicosa-3,5,7-triene-14-carboxylate.
| Compound Name | methyl (9S,11R,14R,15S,16E)-16-ethylidene-12,20-dioxa-2,18-diazaheptacyclo[9.8.1.115,19.01,9.03,8.09,14.013,18]henicosa-3,5,7-triene-14-carboxylate |
|---|---|
| PubChem CID | 134838547 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | methyl (9S,11R,14R,15S,16E)-16-ethylidene-12,20-dioxa-2,18-diazaheptacyclo[9.8.1.115,19.01,9.03,8.09,14.013,18]henicosa-3,5,7-triene-14-carboxylate |
| SMILES | C/C=C1/CN2C3C[C@@H]1[C@]1(C(=O)OC)C2O[C@H]2C[C@]14c1ccccc1NC34O2 |
| InChI | InChI=1S/C21H22N2O4/c1-3-11-10-23-15-8-13(11)20(18(24)25-2)17(23)26-16-9-19(20)12-6-4-5-7-14(12)22-21(15,19)27-16/h3-7,13,15-17,22H,8-10H2,1-2H3/b11-3-/t13-,15?,16+,17?,19-,20+,21?/m0/s1 |
| InChIKey | DQEDBUJNNQTWOB-HYYJKXPNSA-N |
| XLogP | 1.97 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|