C22H26N2O4 — CID 162935108
methyl 5-ethylidene-10-hydroxy-13-methyl-11-oxa-3,13-diazahexacyclo[10.7.1.01,10.03,8.06,20.014,19]icosa-14,16,18-triene-20-carboxylate (PubChem CID 162935108) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 5-ethylidene-10-hydroxy-13-methyl-11-oxa-3,13-diazahexacyclo[10.7.1.01,10.03,8.06,20.014,19]icosa-14,16,18-triene-20-carboxylate.
| Compound Name | methyl 5-ethylidene-10-hydroxy-13-methyl-11-oxa-3,13-diazahexacyclo[10.7.1.01,10.03,8.06,20.014,19]icosa-14,16,18-triene-20-carboxylate |
|---|---|
| PubChem CID | 162935108 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl 5-ethylidene-10-hydroxy-13-methyl-11-oxa-3,13-diazahexacyclo[10.7.1.01,10.03,8.06,20.014,19]icosa-14,16,18-triene-20-carboxylate |
| SMILES | CC=C1CN2CC34c5ccccc5N(C)C5OC3(O)CC2CC1C54C(=O)OC |
| InChI | InChI=1S/C22H26N2O4/c1-4-13-11-24-12-20-15-7-5-6-8-17(15)23(2)18-22(20,19(25)27-3)16(13)9-14(24)10-21(20,26)28-18/h4-8,14,16,18,26H,9-12H2,1-3H3 |
| InChIKey | MKPJEHXIEORFKN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|