C21H24N2O4 — CID 137325442
methyl (1R,2R,15E,16R)-15-ethylidene-18-hydroxy-19-oxa-3,13-diazahexacyclo[14.3.1.02,10.02,13.04,9.010,17]icosa-4,6,8-triene-17-carboxylate (PubChem CID 137325442) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (1R,2R,15E,16R)-15-ethylidene-18-hydroxy-19-oxa-3,13-diazahexacyclo[14.3.1.02,10.02,13.04,9.010,17]icosa-4,6,8-triene-17-carboxylate.
| Compound Name | methyl (1R,2R,15E,16R)-15-ethylidene-18-hydroxy-19-oxa-3,13-diazahexacyclo[14.3.1.02,10.02,13.04,9.010,17]icosa-4,6,8-triene-17-carboxylate |
|---|---|
| PubChem CID | 137325442 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (1R,2R,15E,16R)-15-ethylidene-18-hydroxy-19-oxa-3,13-diazahexacyclo[14.3.1.02,10.02,13.04,9.010,17]icosa-4,6,8-triene-17-carboxylate |
| SMILES | C/C=C1/CN2CCC34c5ccccc5N[C@@]23[C@H]2C[C@H]1C4(C(=O)OC)C(O)O2 |
| InChI | InChI=1S/C21H24N2O4/c1-3-12-11-23-9-8-19-13-6-4-5-7-15(13)22-21(19,23)16-10-14(12)20(19,17(24)26-2)18(25)27-16/h3-7,14,16,18,22,25H,8-11H2,1-2H3/b12-3-/t14-,16-,18?,19?,20?,21+/m1/s1 |
| InChIKey | WOGDQOSWBXSHSL-TVEHPIPOSA-N |
| XLogP | 1.61 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|