C22H24N2O5 — CID 162903454
methyl 14-ethylidene-19-formyl-17-methoxy-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3,5,7-triene-19-carboxylate (PubChem CID 162903454) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is methyl 14-ethylidene-19-formyl-17-methoxy-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3,5,7-triene-19-carboxylate.
| Compound Name | methyl 14-ethylidene-19-formyl-17-methoxy-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3,5,7-triene-19-carboxylate |
|---|---|
| PubChem CID | 162903454 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | methyl 14-ethylidene-19-formyl-17-methoxy-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3,5,7-triene-19-carboxylate |
| SMILES | CC=C1CN2C3CC45c6ccccc6NC4(O3)C2(OC)CC1C5(C=O)C(=O)OC |
| InChI | InChI=1S/C22H24N2O5/c1-4-13-11-24-17-10-20-14-7-5-6-8-16(14)23-22(20,29-17)21(24,28-3)9-15(13)19(20,12-25)18(26)27-2/h4-8,12,15,17,23H,9-11H2,1-3H3 |
| InChIKey | LIWGLODAWURWOU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|