C21H25N2O4+ — CID 177403543
methyl (1S,9S,10S,12S,13E,18R)-13-ethylidene-9-hydroxy-18-(hydroxymethyl)-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6,15-tetraene-18-carboxylate (PubChem CID 177403543) has the molecular formula C21H25N2O4+ and a molecular weight of 369.44 g/mol. Its IUPAC name is methyl (1S,9S,10S,12S,13E,18R)-13-ethylidene-9-hydroxy-18-(hydroxymethyl)-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6,15-tetraene-18-carboxylate.
| Compound Name | methyl (1S,9S,10S,12S,13E,18R)-13-ethylidene-9-hydroxy-18-(hydroxymethyl)-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6,15-tetraene-18-carboxylate |
|---|---|
| PubChem CID | 177403543 |
| Molecular Formula | C21H25N2O4+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | methyl (1S,9S,10S,12S,13E,18R)-13-ethylidene-9-hydroxy-18-(hydroxymethyl)-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6,15-tetraene-18-carboxylate |
| SMILES | C/C=C1/C[N+]2=CC[C@@]34c5ccccc5N[C@@]3(O)[C@@H]2C[C@@H]1[C@@]4(CO)C(=O)OC |
| InChI | InChI=1S/C21H25N2O4/c1-3-13-11-23-9-8-20-14-6-4-5-7-16(14)22-21(20,26)17(23)10-15(13)19(20,12-24)18(25)27-2/h3-7,9,15,17,22,24,26H,8,10-12H2,1-2H3/q+1/b13-3-/t15-,17-,19-,20-,21+/m0/s1 |
| InChIKey | NSCCJYBYEZSONH-JMQZYHTRSA-N |
| XLogP | 1.03 |
| TPSA | 81.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|