C23H28N2O4 — CID 162870326
methyl 2-[(1S,9S,10R,14S,15S)-13-ethylidene-15-(hydroxymethyl)-18-oxo-8,11-diazapentacyclo[7.6.3.110,14.01,9.02,7]nonadeca-2,4,6-trien-15-yl]acetate (PubChem CID 162870326) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 2-[(1S,9S,10R,14S,15S)-13-ethylidene-15-(hydroxymethyl)-18-oxo-8,11-diazapentacyclo[7.6.3.110,14.01,9.02,7]nonadeca-2,4,6-trien-15-yl]acetate.
| Compound Name | methyl 2-[(1S,9S,10R,14S,15S)-13-ethylidene-15-(hydroxymethyl)-18-oxo-8,11-diazapentacyclo[7.6.3.110,14.01,9.02,7]nonadeca-2,4,6-trien-15-yl]acetate |
|---|---|
| PubChem CID | 162870326 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl 2-[(1S,9S,10R,14S,15S)-13-ethylidene-15-(hydroxymethyl)-18-oxo-8,11-diazapentacyclo[7.6.3.110,14.01,9.02,7]nonadeca-2,4,6-trien-15-yl]acetate |
| SMILES | CC=C1CN[C@@H]2C[C@@H]1[C@@](CO)(CC(=O)OC)[C@@]13CCC(=O)[C@@]21Nc1ccccc13 |
| InChI | InChI=1S/C23H28N2O4/c1-3-14-12-24-18-10-16(14)21(13-26,11-20(28)29-2)22-9-8-19(27)23(18,22)25-17-7-5-4-6-15(17)22/h3-7,16,18,24-26H,8-13H2,1-2H3/t16-,18+,21-,22-,23-/m0/s1 |
| InChIKey | UOEMPXBRSQAQTH-DYCPSGBQSA-N |
| XLogP | 1.93 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|