C17H32O4 — CID 134840282
(3E,12E)-8,8-dimethoxypentadeca-3,12-diene-2,14-diol (PubChem CID 134840282) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is (3E,12E)-8,8-dimethoxypentadeca-3,12-diene-2,14-diol.
| Compound Name | (3E,12E)-8,8-dimethoxypentadeca-3,12-diene-2,14-diol |
|---|---|
| PubChem CID | 134840282 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (3E,12E)-8,8-dimethoxypentadeca-3,12-diene-2,14-diol |
| SMILES | COC(CCC/C=C/C(C)O)(CCC/C=C/C(C)O)OC |
| InChI | InChI=1S/C17H32O4/c1-15(18)11-7-5-9-13-17(20-3,21-4)14-10-6-8-12-16(2)19/h7-8,11-12,15-16,18-19H,5-6,9-10,13-14H2,1-4H3/b11-7+,12-8+ |
| InChIKey | KYUWKJBXGBTBOP-MKICQXMISA-N |
| XLogP | 3.19 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|