C25H24ClNO2S2 — CID 134841225
(NE)-N-[2-(4-chlorophenyl)-4-methyl-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide (PubChem CID 134841225) has the molecular formula C25H24ClNO2S2 and a molecular weight of 470.06 g/mol. Its IUPAC name is (NE)-N-[2-(4-chlorophenyl)-4-methyl-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[2-(4-chlorophenyl)-4-methyl-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134841225 |
| Molecular Formula | C25H24ClNO2S2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (NE)-N-[2-(4-chlorophenyl)-4-methyl-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide |
| SMILES | C=C(C)CC(/C=N/S(=O)(=O)c1ccc(C)cc1)(Sc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClNO2S2/c1-19(2)17-25(21-11-13-22(26)14-12-21,30-23-7-5-4-6-8-23)18-27-31(28,29)24-15-9-20(3)10-16-24/h4-16,18H,1,17H2,2-3H3/b27-18+ |
| InChIKey | KFRKRCJVVFHUIV-OVVQPSECSA-N |
| XLogP | 7.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|