C25H25NO3S2 — CID 177410817
(NE)-N-[2-(4-methoxyphenyl)-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide (PubChem CID 177410817) has the molecular formula C25H25NO3S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is (NE)-N-[2-(4-methoxyphenyl)-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[2-(4-methoxyphenyl)-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177410817 |
| Molecular Formula | C25H25NO3S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (NE)-N-[2-(4-methoxyphenyl)-2-phenylsulfanylpent-4-enylidene]-4-methylbenzenesulfonamide |
| SMILES | C=CCC(/C=N/S(=O)(=O)c1ccc(C)cc1)(Sc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H25NO3S2/c1-4-18-25(30-23-8-6-5-7-9-23,21-12-14-22(29-3)15-13-21)19-26-31(27,28)24-16-10-20(2)11-17-24/h4-17,19H,1,18H2,2-3H3/b26-19+ |
| InChIKey | LLGUFKZRNLRUPY-LGUFXXKBSA-N |
| XLogP | 6.03 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|