C15H24O6Si — CID 134841406
methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (PubChem CID 134841406) has the molecular formula C15H24O6Si and a molecular weight of 328.44 g/mol. Its IUPAC name is methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
| Compound Name | methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
|---|---|
| PubChem CID | 134841406 |
| Molecular Formula | C15H24O6Si |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| SMILES | COC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C1=C(C)C(=O)OC1=O |
| InChI | InChI=1S/C15H24O6Si/c1-9-12(14(18)20-13(9)17)10(8-11(16)19-5)21-22(6,7)15(2,3)4/h10H,8H2,1-7H3/t10-/m1/s1 |
| InChIKey | LVYQWEAZJDKNNY-SNVBAGLBSA-N |
| XLogP | 2.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|