C16H28O7Si — CID 101482823
(Z,3R)-6-methoxy-4-methoxycarbonyl-5-methyl-6-oxo-3-triethylsilyloxyhex-4-enoic acid (PubChem CID 101482823) has the molecular formula C16H28O7Si and a molecular weight of 360.48 g/mol. Its IUPAC name is (Z,3R)-6-methoxy-4-methoxycarbonyl-5-methyl-6-oxo-3-triethylsilyloxyhex-4-enoic acid.
| Compound Name | (Z,3R)-6-methoxy-4-methoxycarbonyl-5-methyl-6-oxo-3-triethylsilyloxyhex-4-enoic acid |
|---|---|
| PubChem CID | 101482823 |
| Molecular Formula | C16H28O7Si |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (Z,3R)-6-methoxy-4-methoxycarbonyl-5-methyl-6-oxo-3-triethylsilyloxyhex-4-enoic acid |
| SMILES | CC[Si](CC)(CC)O[C@H](CC(=O)O)/C(C(=O)OC)=C(\C)C(=O)OC |
| InChI | InChI=1S/C16H28O7Si/c1-7-24(8-2,9-3)23-12(10-13(17)18)14(16(20)22-6)11(4)15(19)21-5/h12H,7-10H2,1-6H3,(H,17,18)/b14-11-/t12-/m1/s1 |
| InChIKey | JZYBQSVWSHXGEO-POKNLVKOSA-N |
| XLogP | 2.51 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|