C14H22O6Si — CID 11012477
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid (PubChem CID 11012477) has the molecular formula C14H22O6Si and a molecular weight of 314.41 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid |
|---|---|
| PubChem CID | 11012477 |
| Molecular Formula | C14H22O6Si |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid |
| SMILES | CC1=C([C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)C(=O)OC1=O |
| InChI | InChI=1S/C14H22O6Si/c1-8-11(13(18)19-12(8)17)9(7-10(15)16)20-21(5,6)14(2,3)4/h9H,7H2,1-6H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | WDWNLQCVSPMBSP-SECBINFHSA-N |
| XLogP | 2.25 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|