C17H20N2O — CID 134841926
(4aR,11cR)-4a-ethyl-2,3,4,5,7,11c-hexahydro-1H-pyrido[3,2-c]carbazol-6-one (PubChem CID 134841926) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (4aR,11cR)-4a-ethyl-2,3,4,5,7,11c-hexahydro-1H-pyrido[3,2-c]carbazol-6-one.
| Compound Name | (4aR,11cR)-4a-ethyl-2,3,4,5,7,11c-hexahydro-1H-pyrido[3,2-c]carbazol-6-one |
|---|---|
| PubChem CID | 134841926 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (4aR,11cR)-4a-ethyl-2,3,4,5,7,11c-hexahydro-1H-pyrido[3,2-c]carbazol-6-one |
| SMILES | CC[C@]12CCCN[C@H]1c1c([nH]c3ccccc13)C(=O)C2 |
| InChI | InChI=1S/C17H20N2O/c1-2-17-8-5-9-18-16(17)14-11-6-3-4-7-12(11)19-15(14)13(20)10-17/h3-4,6-7,16,18-19H,2,5,8-10H2,1H3/t16-,17+/m0/s1 |
| InChIKey | LQJXMYLEGHOWAB-DLBZAZTESA-N |
| XLogP | 3.58 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|