C19H23IN2O — CID 11464342
1-[(4aS,11cS)-4a-ethyl-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-1-yl]-2-iodoethanone (PubChem CID 11464342) has the molecular formula C19H23IN2O and a molecular weight of 422.31 g/mol. Its IUPAC name is 1-[(4aS,11cS)-4a-ethyl-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-1-yl]-2-iodoethanone.
| Compound Name | 1-[(4aS,11cS)-4a-ethyl-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-1-yl]-2-iodoethanone |
|---|---|
| PubChem CID | 11464342 |
| Molecular Formula | C19H23IN2O |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 1-[(4aS,11cS)-4a-ethyl-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-1-yl]-2-iodoethanone |
| SMILES | CC[C@@]12CCCN(C(=O)CI)[C@@H]1c1c([nH]c3ccccc13)CC2 |
| InChI | InChI=1S/C19H23IN2O/c1-2-19-9-5-11-22(16(23)12-20)18(19)17-13-6-3-4-7-14(13)21-15(17)8-10-19/h3-4,6-7,18,21H,2,5,8-12H2,1H3/t18-,19+/m1/s1 |
| InChIKey | ADEJLMWAMVRAMR-MOPGFXCFSA-N |
| XLogP | 4.61 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|