C24H28F3N — CID 134842932
2-[2,6-dicyclohexyl-4-(trifluoromethyl)phenyl]pyridine (PubChem CID 134842932) has the molecular formula C24H28F3N and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[2,6-dicyclohexyl-4-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2-[2,6-dicyclohexyl-4-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 134842932 |
| Molecular Formula | C24H28F3N |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-[2,6-dicyclohexyl-4-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1cc(C2CCCCC2)c(-c2ccccn2)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C24H28F3N/c25-24(26,27)19-15-20(17-9-3-1-4-10-17)23(22-13-7-8-14-28-22)21(16-19)18-11-5-2-6-12-18/h7-8,13-18H,1-6,9-12H2 |
| InChIKey | QFKALRQTUYJJPR-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |