C18H22O2Si — CID 134843117
(3S)-3-[dimethyl(phenyl)silyl]-3-(4-methoxyphenyl)propanal (PubChem CID 134843117) has the molecular formula C18H22O2Si and a molecular weight of 298.46 g/mol. Its IUPAC name is (3S)-3-[dimethyl(phenyl)silyl]-3-(4-methoxyphenyl)propanal.
| Compound Name | (3S)-3-[dimethyl(phenyl)silyl]-3-(4-methoxyphenyl)propanal |
|---|---|
| PubChem CID | 134843117 |
| Molecular Formula | C18H22O2Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3S)-3-[dimethyl(phenyl)silyl]-3-(4-methoxyphenyl)propanal |
| SMILES | COc1ccc([C@H](CC=O)[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22O2Si/c1-20-16-11-9-15(10-12-16)18(13-14-19)21(2,3)17-7-5-4-6-8-17/h4-12,14,18H,13H2,1-3H3/t18-/m0/s1 |
| InChIKey | UUXFTBYTHUCZHU-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|