C53H59NO6Si — CID 134843274
[(2S,3R,4S)-4-[(3S)-2-benzyl-4-methoxy-3,6-dihydrooxazin-3-yl]-2,3,4-tris(phenylmethoxy)butoxy]-tert-butyl-diphenylsilane (PubChem CID 134843274) has the molecular formula C53H59NO6Si and a molecular weight of 834.14 g/mol. Its IUPAC name is [(2S,3R,4S)-4-[(3S)-2-benzyl-4-methoxy-3,6-dihydrooxazin-3-yl]-2,3,4-tris(phenylmethoxy)butoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3R,4S)-4-[(3S)-2-benzyl-4-methoxy-3,6-dihydrooxazin-3-yl]-2,3,4-tris(phenylmethoxy)butoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134843274 |
| Molecular Formula | C53H59NO6Si |
| Molecular Weight | 834.14 g/mol |
| Exact Mass | 833.41 |
| IUPAC Name | [(2S,3R,4S)-4-[(3S)-2-benzyl-4-methoxy-3,6-dihydrooxazin-3-yl]-2,3,4-tris(phenylmethoxy)butoxy]-tert-butyl-diphenylsilane |
| SMILES | COC1=CCON(Cc2ccccc2)[C@H]1[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C53H59NO6Si/c1-53(2,3)61(46-31-19-9-20-32-46,47-33-21-10-22-34-47)60-41-49(56-38-43-25-13-6-14-26-43)51(57-39-44-27-15-7-16-28-44)52(58-40-45-29-17-8-18-30-45)50-48(55-4)35-36-59-54(50)37-42-23-11-5-12-24-42/h5-35,49-52H,36-41H2,1-4H3/t49-,50+,51-,52-/m0/s1 |
| InChIKey | AOQPOKVQRLUAEJ-UYATXGGZSA-N |
| XLogP | 9.67 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.14 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|