C37H41NO6 — CID 134843278
(4aS,7R,8R,9S,9aS)-1-benzyl-4a-methoxy-7,8,9-tris(phenylmethoxy)-4,6,7,8,9,9a-hexahydro-3H-oxepino[3,2-c]oxazine (PubChem CID 134843278) has the molecular formula C37H41NO6 and a molecular weight of 595.74 g/mol. Its IUPAC name is (4aS,7R,8R,9S,9aS)-1-benzyl-4a-methoxy-7,8,9-tris(phenylmethoxy)-4,6,7,8,9,9a-hexahydro-3H-oxepino[3,2-c]oxazine.
| Compound Name | (4aS,7R,8R,9S,9aS)-1-benzyl-4a-methoxy-7,8,9-tris(phenylmethoxy)-4,6,7,8,9,9a-hexahydro-3H-oxepino[3,2-c]oxazine |
|---|---|
| PubChem CID | 134843278 |
| Molecular Formula | C37H41NO6 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | (4aS,7R,8R,9S,9aS)-1-benzyl-4a-methoxy-7,8,9-tris(phenylmethoxy)-4,6,7,8,9,9a-hexahydro-3H-oxepino[3,2-c]oxazine |
| SMILES | CO[C@]12CCON(Cc3ccccc3)[C@H]1[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)CO2 |
| InChI | InChI=1S/C37H41NO6/c1-39-37-22-23-44-38(24-29-14-6-2-7-15-29)36(37)35(42-27-32-20-12-5-13-21-32)34(41-26-31-18-10-4-11-19-31)33(28-43-37)40-25-30-16-8-3-9-17-30/h2-21,33-36H,22-28H2,1H3/t33-,34+,35-,36+,37+/m1/s1 |
| InChIKey | MYDLNUIEZCGSLR-VIMWANRLSA-N |
| XLogP | 6.32 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |