C19H22O2Si — CID 134843965
5-triethylsilylphenalene-1,3-dione (PubChem CID 134843965) has the molecular formula C19H22O2Si and a molecular weight of 310.47 g/mol. Its IUPAC name is 5-triethylsilylphenalene-1,3-dione.
| Compound Name | 5-triethylsilylphenalene-1,3-dione |
|---|---|
| PubChem CID | 134843965 |
| Molecular Formula | C19H22O2Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-triethylsilylphenalene-1,3-dione |
| SMILES | CC[Si](CC)(CC)c1cc2c3c(cccc3c1)C(=O)CC2=O |
| InChI | InChI=1S/C19H22O2Si/c1-4-22(5-2,6-3)14-10-13-8-7-9-15-17(20)12-18(21)16(11-14)19(13)15/h7-11H,4-6,12H2,1-3H3 |
| InChIKey | JDBGLAIUSROEKJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|