C23H28O7S — CID 134844651
ethyl (E,4S,5R,6R)-4-(benzenesulfonylmethyl)-5,6-dihydroxy-7-phenylmethoxyhept-2-enoate (PubChem CID 134844651) has the molecular formula C23H28O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl (E,4S,5R,6R)-4-(benzenesulfonylmethyl)-5,6-dihydroxy-7-phenylmethoxyhept-2-enoate.
| Compound Name | ethyl (E,4S,5R,6R)-4-(benzenesulfonylmethyl)-5,6-dihydroxy-7-phenylmethoxyhept-2-enoate |
|---|---|
| PubChem CID | 134844651 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | ethyl (E,4S,5R,6R)-4-(benzenesulfonylmethyl)-5,6-dihydroxy-7-phenylmethoxyhept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CS(=O)(=O)c1ccccc1)[C@@H](O)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C23H28O7S/c1-2-30-22(25)14-13-19(17-31(27,28)20-11-7-4-8-12-20)23(26)21(24)16-29-15-18-9-5-3-6-10-18/h3-14,19,21,23-24,26H,2,15-17H2,1H3/b14-13+/t19-,21-,23-/m1/s1 |
| InChIKey | HSTFYBYHXSGNDP-IOTPXRDWSA-N |
| XLogP | 2.13 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|