C26H32O7S — CID 134844705
ethyl (E,4S)-5-(benzenesulfonyl)-4-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-2-enoate (PubChem CID 134844705) has the molecular formula C26H32O7S and a molecular weight of 488.60 g/mol. Its IUPAC name is ethyl (E,4S)-5-(benzenesulfonyl)-4-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-5-(benzenesulfonyl)-4-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-2-enoate |
|---|---|
| PubChem CID | 134844705 |
| Molecular Formula | C26H32O7S |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | ethyl (E,4S)-5-(benzenesulfonyl)-4-[(4R,5R)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CS(=O)(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C26H32O7S/c1-4-31-24(27)16-15-21(19-34(28,29)22-13-9-6-10-14-22)25-23(32-26(2,3)33-25)18-30-17-20-11-7-5-8-12-20/h5-16,21,23,25H,4,17-19H2,1-3H3/b16-15+/t21-,23-,25-/m1/s1 |
| InChIKey | KGHAGDMKGGHGNV-JCVXTPRRSA-N |
| XLogP | 3.93 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|