About methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate
methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate (PubChem CID 134845126) has the molecular formula C21H17NO3
and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate |
| PubChem CID | 134845126 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate |
| SMILES | COC(=O)C1=CC=C(c2ccccc2)C12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C21H17NO3/c1-22-18-11-7-6-10-16(18)21(20(22)24)15(14-8-4-3-5-9-14)12-13-17(21)19(23)25-2/h3-13H,1-2H3 |
| InChIKey | GCUGEHNRNSJTFW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate?
The IUPAC name of methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate (CID 134845126) is methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate.
What is the SMILES notation for methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate?
The canonical SMILES for methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate is COC(=O)C1=CC=C(c2ccccc2)C12C(=O)N(C)c1ccccc12.
What is the InChIKey of methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate?
The InChIKey is GCUGEHNRNSJTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO3/c1-22-18-11-7-6-10-16(18)21(20(22)24)15(14-8-4-3-5-9-14)12-13-17(21)19(23)25-2/h3-13H,1-2H3.
What are the key properties of methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate?
methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate has a molecular weight of 331.37 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1'-methyl-2'-oxo-4-phenylspiro[cyclopenta-1,3-diene-5,3'-indole]-1-carboxylate is sourced from PubChem (CID 134845126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).