C25H40O3Si — CID 134845645
benzyl (7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-2-ynoate (PubChem CID 134845645) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is benzyl (7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-2-ynoate.
| Compound Name | benzyl (7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-2-ynoate |
|---|---|
| PubChem CID | 134845645 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | benzyl (7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-2-ynoate |
| SMILES | CC(C)[Si](OC[C@@H](C)CCCC#CC(=O)OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H40O3Si/c1-20(2)29(21(3)4,22(5)6)28-18-23(7)14-10-8-13-17-25(26)27-19-24-15-11-9-12-16-24/h9,11-12,15-16,20-23H,8,10,14,18-19H2,1-7H3/t23-/m0/s1 |
| InChIKey | RBVOOHIYALIDCZ-QHCPKHFHSA-N |
| XLogP | 6.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|