C10H16O2 — CID 13484568
(3aR,6R,6aS)-6-methoxy-6a-methyl-1,3,3a,4,5,6-hexahydropentalen-2-one (PubChem CID 13484568) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3aR,6R,6aS)-6-methoxy-6a-methyl-1,3,3a,4,5,6-hexahydropentalen-2-one.
| Compound Name | (3aR,6R,6aS)-6-methoxy-6a-methyl-1,3,3a,4,5,6-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 13484568 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3aR,6R,6aS)-6-methoxy-6a-methyl-1,3,3a,4,5,6-hexahydropentalen-2-one |
| SMILES | CO[C@@H]1CC[C@@H]2CC(=O)C[C@@]21C |
| InChI | InChI=1S/C10H16O2/c1-10-6-8(11)5-7(10)3-4-9(10)12-2/h7,9H,3-6H2,1-2H3/t7-,9-,10+/m1/s1 |
| InChIKey | GVZQNHZNCWIQBG-QNSHHTMESA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |