C13H20O2 — CID 135075573
(3aS,5aR,9aR)-4-methoxy-1,2,3,3a,4,5,5a,6,7,8-decahydrocyclopenta[i]inden-9-one (PubChem CID 135075573) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (3aS,5aR,9aR)-4-methoxy-1,2,3,3a,4,5,5a,6,7,8-decahydrocyclopenta[i]inden-9-one.
| Compound Name | (3aS,5aR,9aR)-4-methoxy-1,2,3,3a,4,5,5a,6,7,8-decahydrocyclopenta[i]inden-9-one |
|---|---|
| PubChem CID | 135075573 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (3aS,5aR,9aR)-4-methoxy-1,2,3,3a,4,5,5a,6,7,8-decahydrocyclopenta[i]inden-9-one |
| SMILES | COC1C[C@H]2CCCC(=O)[C@]23CCC[C@H]13 |
| InChI | InChI=1S/C13H20O2/c1-15-11-8-9-4-2-6-12(14)13(9)7-3-5-10(11)13/h9-11H,2-8H2,1H3/t9-,10-,11?,13-/m1/s1 |
| InChIKey | FWYJOZSJSNGZGR-SQNVCAFISA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |