C17H20N2O — CID 134846042
(4R)-4-ethyl-1-methyl-3,3a,4,5,10,10b-hexahydropyrrolo[2,3-a]carbazol-2-one (PubChem CID 134846042) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (4R)-4-ethyl-1-methyl-3,3a,4,5,10,10b-hexahydropyrrolo[2,3-a]carbazol-2-one.
| Compound Name | (4R)-4-ethyl-1-methyl-3,3a,4,5,10,10b-hexahydropyrrolo[2,3-a]carbazol-2-one |
|---|---|
| PubChem CID | 134846042 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (4R)-4-ethyl-1-methyl-3,3a,4,5,10,10b-hexahydropyrrolo[2,3-a]carbazol-2-one |
| SMILES | CC[C@@H]1Cc2c([nH]c3ccccc23)C2C1CC(=O)N2C |
| InChI | InChI=1S/C17H20N2O/c1-3-10-8-13-11-6-4-5-7-14(11)18-16(13)17-12(10)9-15(20)19(17)2/h4-7,10,12,17-18H,3,8-9H2,1-2H3/t10-,12?,17?/m1/s1 |
| InChIKey | HXSLIUIPYBIFBW-MMODKWEGSA-N |
| XLogP | 3.27 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|