C10H7F6IO6S2 — CID 134846291
[4-ethyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 134846291) has the molecular formula C10H7F6IO6S2 and a molecular weight of 528.19 g/mol. Its IUPAC name is [4-ethyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-ethyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134846291 |
| Molecular Formula | C10H7F6IO6S2 |
| Molecular Weight | 528.19 g/mol |
| Exact Mass | 527.86 |
| IUPAC Name | [4-ethyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | CCc1ccc(OS(=O)(=O)C(F)(F)F)c(I)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H7F6IO6S2/c1-2-5-3-4-6(22-24(18,19)9(11,12)13)7(17)8(5)23-25(20,21)10(14,15)16/h3-4H,2H2,1H3 |
| InChIKey | FOISBNXZKOMSIJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|