C27H26F6O7S2Si — CID 135011141
[5-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enyl-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 135011141) has the molecular formula C27H26F6O7S2Si and a molecular weight of 668.71 g/mol. Its IUPAC name is [5-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enyl-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [5-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enyl-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135011141 |
| Molecular Formula | C27H26F6O7S2Si |
| Molecular Weight | 668.71 g/mol |
| Exact Mass | 668.08 |
| IUPAC Name | [5-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enyl-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | C=CCc1c(OS(=O)(=O)C(F)(F)F)cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C27H26F6O7S2Si/c1-5-12-22-23(38-41(34,35)26(28,29)30)17-19(18-24(22)39-42(36,37)27(31,32)33)40-43(25(2,3)4,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h5-11,13-18H,1,12H2,2-4H3 |
| InChIKey | XJSQVOGEJFVNJB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|