C31H37F3O5SSi — CID 11734717
[2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 11734717) has the molecular formula C31H37F3O5SSi and a molecular weight of 606.78 g/mol. Its IUPAC name is [2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11734717 |
| Molecular Formula | C31H37F3O5SSi |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | [2-[(Z)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-4-enyl]-5-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(CCC/C(C)=C\CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C31H37F3O5SSi/c1-24(13-12-14-25-19-20-26(37-5)23-29(25)39-40(35,36)31(32,33)34)21-22-38-41(30(2,3)4,27-15-8-6-9-16-27)28-17-10-7-11-18-28/h6-11,15-21,23H,12-14,22H2,1-5H3/b24-21- |
| InChIKey | NTPXKBJNFRLJFD-FLFQWRMESA-N |
| XLogP | 6.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|