C16H12F6O8S2 — CID 10864133
[3-methoxy-2-[2-methoxy-6-(trifluoromethylsulfonyloxy)phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 10864133) has the molecular formula C16H12F6O8S2 and a molecular weight of 510.39 g/mol. Its IUPAC name is [3-methoxy-2-[2-methoxy-6-(trifluoromethylsulfonyloxy)phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-methoxy-2-[2-methoxy-6-(trifluoromethylsulfonyloxy)phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10864133 |
| Molecular Formula | C16H12F6O8S2 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | [3-methoxy-2-[2-methoxy-6-(trifluoromethylsulfonyloxy)phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | COc1cccc(OS(=O)(=O)C(F)(F)F)c1-c1c(OC)cccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H12F6O8S2/c1-27-9-5-3-7-11(29-31(23,24)15(17,18)19)13(9)14-10(28-2)6-4-8-12(14)30-32(25,26)16(20,21)22/h3-8H,1-2H3 |
| InChIKey | MEEBHUGSLGQKSW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|