C28H28F3IO7S — CID 10963524
[2-iodo-3-methoxy-4-[(2R,4R,5R,6R)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 10963524) has the molecular formula C28H28F3IO7S and a molecular weight of 692.49 g/mol. Its IUPAC name is [2-iodo-3-methoxy-4-[(2R,4R,5R,6R)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-iodo-3-methoxy-4-[(2R,4R,5R,6R)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10963524 |
| Molecular Formula | C28H28F3IO7S |
| Molecular Weight | 692.49 g/mol |
| Exact Mass | 692.06 |
| IUPAC Name | [2-iodo-3-methoxy-4-[(2R,4R,5R,6R)-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COc1c([C@H]2C[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](C)O2)ccc(OS(=O)(=O)C(F)(F)F)c1I |
| InChI | InChI=1S/C28H28F3IO7S/c1-18-26(37-17-20-11-7-4-8-12-20)24(36-16-19-9-5-3-6-10-19)15-23(38-18)21-13-14-22(25(32)27(21)35-2)39-40(33,34)28(29,30)31/h3-14,18,23-24,26H,15-17H2,1-2H3/t18-,23-,24-,26-/m1/s1 |
| InChIKey | QXSRQZNLOWKSOI-OQXOQRCNSA-N |
| XLogP | 6.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|