C41H38F3IO8S — CID 15168584
[6-[(2S,3R,4S,5R)-3,4-bis(phenylmethoxy)-5-[(1S)-1-phenylmethoxyethyl]oxolan-2-yl]-2-iodo-3-phenylmethoxyphenyl] trifluoromethanesulfonate (PubChem CID 15168584) has the molecular formula C41H38F3IO8S and a molecular weight of 874.71 g/mol. Its IUPAC name is [6-[(2S,3R,4S,5R)-3,4-bis(phenylmethoxy)-5-[(1S)-1-phenylmethoxyethyl]oxolan-2-yl]-2-iodo-3-phenylmethoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [6-[(2S,3R,4S,5R)-3,4-bis(phenylmethoxy)-5-[(1S)-1-phenylmethoxyethyl]oxolan-2-yl]-2-iodo-3-phenylmethoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15168584 |
| Molecular Formula | C41H38F3IO8S |
| Molecular Weight | 874.71 g/mol |
| Exact Mass | 874.13 |
| IUPAC Name | [6-[(2S,3R,4S,5R)-3,4-bis(phenylmethoxy)-5-[(1S)-1-phenylmethoxyethyl]oxolan-2-yl]-2-iodo-3-phenylmethoxyphenyl] trifluoromethanesulfonate |
| SMILES | C[C@H](OCc1ccccc1)[C@H]1O[C@@H](c2ccc(OCc3ccccc3)c(I)c2OS(=O)(=O)C(F)(F)F)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H38F3IO8S/c1-28(48-24-29-14-6-2-7-15-29)36-39(50-26-31-18-10-4-11-19-31)40(51-27-32-20-12-5-13-21-32)38(52-36)33-22-23-34(49-25-30-16-8-3-9-17-30)35(45)37(33)53-54(46,47)41(42,43)44/h2-23,28,36,38-40H,24-27H2,1H3/t28-,36+,38-,39+,40+/m0/s1 |
| InChIKey | BWDUNKXCKDDSOI-BSHDYQAYSA-N |
| XLogP | 9.31 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.71 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|