C16H21F3O5S — CID 146161959
[4-[(3S)-hept-1-en-3-yl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate (PubChem CID 146161959) has the molecular formula C16H21F3O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is [4-[(3S)-hept-1-en-3-yl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(3S)-hept-1-en-3-yl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146161959 |
| Molecular Formula | C16H21F3O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [4-[(3S)-hept-1-en-3-yl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate |
| SMILES | C=C[C@H](CCCC)c1c(OC)cc(OS(=O)(=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C16H21F3O5S/c1-5-7-8-11(6-2)15-13(22-3)9-12(10-14(15)23-4)24-25(20,21)16(17,18)19/h6,9-11H,2,5,7-8H2,1,3-4H3/t11-/m1/s1 |
| InChIKey | BYDVEJROQUYURB-LLVKDONJSA-N |
| XLogP | 4.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|