C26H21F3O4SSi — CID 134878111
[4-(triphenylsilyloxymethyl)phenyl] trifluoromethanesulfonate (PubChem CID 134878111) has the molecular formula C26H21F3O4SSi and a molecular weight of 514.60 g/mol. Its IUPAC name is [4-(triphenylsilyloxymethyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(triphenylsilyloxymethyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134878111 |
| Molecular Formula | C26H21F3O4SSi |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | [4-(triphenylsilyloxymethyl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H21F3O4SSi/c27-26(28,29)34(30,31)33-22-18-16-21(17-19-22)20-32-35(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-19H,20H2 |
| InChIKey | XCWKNCKVLNUJSE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|